C23H25ClN6O2 — CID 171772675
5-tert-butyl-8-[(4-chlorophenyl)methyl]-11-[(3R)-3-hydroxypyrrolidin-1-yl]-3,4,6,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one (PubChem CID 171772675) has the molecular formula C23H25ClN6O2 and a molecular weight of 452.95 g/mol. Its IUPAC name is 5-tert-butyl-8-[(4-chlorophenyl)methyl]-11-[(3R)-3-hydroxypyrrolidin-1-yl]-3,4,6,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one.
| Compound Name | 5-tert-butyl-8-[(4-chlorophenyl)methyl]-11-[(3R)-3-hydroxypyrrolidin-1-yl]-3,4,6,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 171772675 |
| Molecular Formula | C23H25ClN6O2 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 5-tert-butyl-8-[(4-chlorophenyl)methyl]-11-[(3R)-3-hydroxypyrrolidin-1-yl]-3,4,6,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
| SMILES | CC(C)(C)c1nnc2c3ncc(N4CC[C@@H](O)C4)cc3n(Cc3ccc(Cl)cc3)c(=O)n12 |
| InChI | InChI=1S/C23H25ClN6O2/c1-23(2,3)21-27-26-20-19-18(10-16(11-25-19)28-9-8-17(31)13-28)29(22(32)30(20)21)12-14-4-6-15(24)7-5-14/h4-7,10-11,17,31H,8-9,12-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | BSTQMYUUTUFKKG-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |