2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid

C10H6FNO2S — CID 171772921

IUPAC2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid
SMILESO=C(O)c1ccc(-c2cncs2)cc1F
InChIInChI=1S/C10H6FNO2S/c11-8-3-6(9-4-12-5-15-9)1-2-7(8)10(13)14/h1-5H,(H,13,14)
InChIKeyBRZSXWMKSQZXDN-UHFFFAOYSA-N
MW223.23 g/mol
LogP2.65
Rot. Bonds2

About 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid

2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid (PubChem CID 171772921) has the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid.

Molecular Properties

Compound Name2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid
PubChem CID171772921
Molecular FormulaC10H6FNO2S
Molecular Weight223.23 g/mol
Exact Mass223.01
IUPAC Name2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid
SMILESO=C(O)c1ccc(-c2cncs2)cc1F
InChIInChI=1S/C10H6FNO2S/c11-8-3-6(9-4-12-5-15-9)1-2-7(8)10(13)14/h1-5H,(H,13,14)
InChIKeyBRZSXWMKSQZXDN-UHFFFAOYSA-N
XLogP2.65
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.23
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid?
The IUPAC name of 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid (CID 171772921) is 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid.
What is the SMILES notation for 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid?
The canonical SMILES for 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid is O=C(O)c1ccc(-c2cncs2)cc1F.
What is the InChIKey of 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid?
The InChIKey is BRZSXWMKSQZXDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6FNO2S/c11-8-3-6(9-4-12-5-15-9)1-2-7(8)10(13)14/h1-5H,(H,13,14).
What are the key properties of 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid?
2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid has a molecular weight of 223.23 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(1,3-thiazol-5-yl)benzoic acid is sourced from PubChem (CID 171772921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).