C19H24N4O4S — CID 171773895
N-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(1,2,3,4-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide (PubChem CID 171773895) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(1,2,3,4-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(1,2,3,4-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 171773895 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(1,2,3,4-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
| SMILES | Cc1nnc(NC(=O)C2CCN(S(=O)(=O)C3CCc4ccccc4C3)CC2)o1 |
| InChI | InChI=1S/C19H24N4O4S/c1-13-21-22-19(27-13)20-18(24)15-8-10-23(11-9-15)28(25,26)17-7-6-14-4-2-3-5-16(14)12-17/h2-5,15,17H,6-12H2,1H3,(H,20,22,24) |
| InChIKey | NOTHHHFWZBNHOI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |