C21H19FN2OS — CID 171773945
1-(4-fluorophenyl)-2-(11-thia-2,5-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-5-yl)ethanone (PubChem CID 171773945) has the molecular formula C21H19FN2OS and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-(11-thia-2,5-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-5-yl)ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-(11-thia-2,5-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-5-yl)ethanone |
|---|---|
| PubChem CID | 171773945 |
| Molecular Formula | C21H19FN2OS |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-(4-fluorophenyl)-2-(11-thia-2,5-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-5-yl)ethanone |
| SMILES | O=C(CN1CCN2c3cccc4scc(c34)CC2C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2OS/c22-16-6-4-14(5-7-16)19(25)12-23-8-9-24-17(11-23)10-15-13-26-20-3-1-2-18(24)21(15)20/h1-7,13,17H,8-12H2 |
| InChIKey | WYLSPANLEOMBML-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |