C28H35N5O5S — CID 171774039
(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(4-methoxypiperidin-1-yl)phenyl]methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171774039) has the molecular formula C28H35N5O5S and a molecular weight of 553.69 g/mol. Its IUPAC name is (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(4-methoxypiperidin-1-yl)phenyl]methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(4-methoxypiperidin-1-yl)phenyl]methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171774039 |
| Molecular Formula | C28H35N5O5S |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(4-methoxypiperidin-1-yl)phenyl]methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | COC1CCN(c2ccc(CN3C(=O)[C@@H](N)CS(=O)(=O)c4ccc(-c5nnc(C(C)(C)C)o5)cc43)cc2)CC1 |
| InChI | InChI=1S/C28H35N5O5S/c1-28(2,3)27-31-30-25(38-27)19-7-10-24-23(15-19)33(26(34)22(29)17-39(24,35)36)16-18-5-8-20(9-6-18)32-13-11-21(37-4)12-14-32/h5-10,15,21-22H,11-14,16-17,29H2,1-4H3/t22-/m0/s1 |
| InChIKey | XGBNXYOAEKSHCY-QFIPXVFZSA-N |
| XLogP | 3.30 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|