About tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine
tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine (PubChem CID 171774274) has the molecular formula C21H26BrN3O6
and a molecular weight of 496.36 g/mol. Its IUPAC name is tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine.
Molecular Properties
| Compound Name | tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine |
| PubChem CID | 171774274 |
| Molecular Formula | C21H26BrN3O6 |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cc(Br)cc([N+](=O)[O-])c1.c1ccncc1 |
| InChI | InChI=1S/C16H21BrN2O6.C5H5N/c1-15(2,3)24-13(20)18(14(21)25-16(4,5)6)11-7-10(17)8-12(9-11)19(22)23;1-2-4-6-5-3-1/h7-9H,1-6H3;1-5H |
| InChIKey | NFNCWWWGRSJOMG-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine?
The IUPAC name of tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine (CID 171774274) is tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine.
What is the SMILES notation for tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine?
The canonical SMILES for tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine is CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cc(Br)cc([N+](=O)[O-])c1.c1ccncc1.
What is the InChIKey of tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine?
The InChIKey is NFNCWWWGRSJOMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrN2O6.C5H5N/c1-15(2,3)24-13(20)18(14(21)25-16(4,5)6)11-7-10(17)8-12(9-11)19(22)23;1-2-4-6-5-3-1/h7-9H,1-6H3;1-5H.
What are the key properties of tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine?
tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine has a molecular weight of 496.36 g/mol, XLogP of 6.12, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(3-bromo-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;pyridine is sourced from PubChem (CID 171774274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).