C16H17BrCl2N2O2 — CID 171774968
10-bromo-7,8-dichloro-5-(2-hydroxypropyl)-6-methyl-1,3,4,5-tetrahydroazepino[4,5-b]indol-2-one (PubChem CID 171774968) has the molecular formula C16H17BrCl2N2O2 and a molecular weight of 420.13 g/mol. Its IUPAC name is 10-bromo-7,8-dichloro-5-(2-hydroxypropyl)-6-methyl-1,3,4,5-tetrahydroazepino[4,5-b]indol-2-one.
| Compound Name | 10-bromo-7,8-dichloro-5-(2-hydroxypropyl)-6-methyl-1,3,4,5-tetrahydroazepino[4,5-b]indol-2-one |
|---|---|
| PubChem CID | 171774968 |
| Molecular Formula | C16H17BrCl2N2O2 |
| Molecular Weight | 420.13 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 10-bromo-7,8-dichloro-5-(2-hydroxypropyl)-6-methyl-1,3,4,5-tetrahydroazepino[4,5-b]indol-2-one |
| SMILES | CC(O)CC1CNC(=O)Cc2c1n(C)c1c(Cl)c(Cl)cc(Br)c21 |
| InChI | InChI=1S/C16H17BrCl2N2O2/c1-7(22)3-8-6-20-12(23)4-9-13-10(17)5-11(18)14(19)16(13)21(2)15(8)9/h5,7-8,22H,3-4,6H2,1-2H3,(H,20,23) |
| InChIKey | GSDLAYPZYJRTLQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.13 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|