About bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium
bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium (PubChem CID 171776006) has the molecular formula C12H24N2O3P+
and a molecular weight of 275.31 g/mol. Its IUPAC name is bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium.
Molecular Properties
| Compound Name | bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium |
| PubChem CID | 171776006 |
| Molecular Formula | C12H24N2O3P+ |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium |
| SMILES | C=CC[NH2+]CC=C.C=CC[NH2+]CC=C.O=[P+]([O-])[O-] |
| InChI | InChI=1S/2C6H11N.HO3P/c2*1-3-5-7-6-4-2;1-4(2)3/h2*3-4,7H,1-2,5-6H2;(H,1,2,3)/p+1 |
| InChIKey | WZJQEVOBAGBJDK-UHFFFAOYSA-O |
| XLogP | -1.79 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium?
The IUPAC name of bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium (CID 171776006) is bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium.
What is the SMILES notation for bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium?
The canonical SMILES for bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium is C=CC[NH2+]CC=C.C=CC[NH2+]CC=C.O=[P+]([O-])[O-].
What is the InChIKey of bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium?
The InChIKey is WZJQEVOBAGBJDK-UHFFFAOYSA-O. The full InChI is InChI=1S/2C6H11N.HO3P/c2*1-3-5-7-6-4-2;1-4(2)3/h2*3-4,7H,1-2,5-6H2;(H,1,2,3)/p+1.
What are the key properties of bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium?
bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium has a molecular weight of 275.31 g/mol, XLogP of -1.79, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bis(prop-2-enyl)azanium);dioxido(oxo)phosphanium is sourced from PubChem (CID 171776006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).