About [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol
[1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol (PubChem CID 171778085) has the molecular formula C12H14ClN3O2
and a molecular weight of 267.72 g/mol. Its IUPAC name is [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol |
| PubChem CID | 171778085 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2nc3nc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C12H14ClN3O2/c13-10-2-1-9-11(14-10)15-12(18-9)16-5-3-8(7-17)4-6-16/h1-2,8,17H,3-7H2 |
| InChIKey | IFJPFYRIFMYNSW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol?
The IUPAC name of [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol (CID 171778085) is [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol.
What is the SMILES notation for [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol?
The canonical SMILES for [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol is OCC1CCN(c2nc3nc(Cl)ccc3o2)CC1.
What is the InChIKey of [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol?
The InChIKey is IFJPFYRIFMYNSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O2/c13-10-2-1-9-11(14-10)15-12(18-9)16-5-3-8(7-17)4-6-16/h1-2,8,17H,3-7H2.
What are the key properties of [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol?
[1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol has a molecular weight of 267.72 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]methanol is sourced from PubChem (CID 171778085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).