About (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one
(4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one (PubChem CID 171778866) has the molecular formula C11H13F3N2O
and a molecular weight of 246.23 g/mol. Its IUPAC name is (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one |
| PubChem CID | 171778866 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one |
| SMILES | O=C1N[C@H](C(F)(F)F)CN1CC1=CCCC=C1 |
| InChI | InChI=1S/C11H13F3N2O/c12-11(13,14)9-7-16(10(17)15-9)6-8-4-2-1-3-5-8/h2,4-5,9H,1,3,6-7H2,(H,15,17)/t9-/m0/s1 |
| InChIKey | FFNKJCOROPFTEX-VIFPVBQESA-N |
| XLogP | 2.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one?
The IUPAC name of (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one (CID 171778866) is (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one.
What is the SMILES notation for (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one?
The canonical SMILES for (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one is O=C1N[C@H](C(F)(F)F)CN1CC1=CCCC=C1.
What is the InChIKey of (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one?
The InChIKey is FFNKJCOROPFTEX-VIFPVBQESA-N. The full InChI is InChI=1S/C11H13F3N2O/c12-11(13,14)9-7-16(10(17)15-9)6-8-4-2-1-3-5-8/h2,4-5,9H,1,3,6-7H2,(H,15,17)/t9-/m0/s1.
What are the key properties of (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one?
(4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one has a molecular weight of 246.23 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-(cyclohexa-1,5-dien-1-ylmethyl)-4-(trifluoromethyl)imidazolidin-2-one is sourced from PubChem (CID 171778866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).