About 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione
1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione (PubChem CID 171779044) has the molecular formula C22H21BrFNO4
and a molecular weight of 462.32 g/mol. Its IUPAC name is 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione.
Molecular Properties
| Compound Name | 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione |
| PubChem CID | 171779044 |
| Molecular Formula | C22H21BrFNO4 |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)N1C(=O)OC[C@H]1Cc1ccccc1)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C22H21BrFNO4/c23-17-11-16(12-18(24)13-17)20(26)8-4-5-9-21(27)25-19(14-29-22(25)28)10-15-6-2-1-3-7-15/h1-3,6-7,11-13,19H,4-5,8-10,14H2/t19-/m1/s1 |
| InChIKey | QISSNRNNQBMOJH-LJQANCHMSA-N |
| XLogP | 4.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione?
The IUPAC name of 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione (CID 171779044) is 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione.
What is the SMILES notation for 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione?
The canonical SMILES for 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione is O=C(CCCCC(=O)N1C(=O)OC[C@H]1Cc1ccccc1)c1cc(F)cc(Br)c1.
What is the InChIKey of 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione?
The InChIKey is QISSNRNNQBMOJH-LJQANCHMSA-N. The full InChI is InChI=1S/C22H21BrFNO4/c23-17-11-16(12-18(24)13-17)20(26)8-4-5-9-21(27)25-19(14-29-22(25)28)10-15-6-2-1-3-7-15/h1-3,6-7,11-13,19H,4-5,8-10,14H2/t19-/m1/s1.
What are the key properties of 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione?
1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione has a molecular weight of 462.32 g/mol, XLogP of 4.92, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione is sourced from PubChem (CID 171779044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).