C6H11N3O2 — CID 171779364
N-methyl-2-(2-prop-2-enoylhydrazinyl)acetamide (PubChem CID 171779364) has the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. Its IUPAC name is N-methyl-2-(2-prop-2-enoylhydrazinyl)acetamide.
| Compound Name | N-methyl-2-(2-prop-2-enoylhydrazinyl)acetamide |
|---|---|
| PubChem CID | 171779364 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N-methyl-2-(2-prop-2-enoylhydrazinyl)acetamide |
| SMILES | C=CC(=O)NNCC(=O)NC |
| InChI | InChI=1S/C6H11N3O2/c1-3-5(10)9-8-4-6(11)7-2/h3,8H,1,4H2,2H3,(H,7,11)(H,9,10) |
| InChIKey | LNBIOPKCQKSCSW-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|