About 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol
1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol (PubChem CID 171779384) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol.
Molecular Properties
| Compound Name | 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol |
| PubChem CID | 171779384 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol |
| SMILES | Nc1ccc(C2(O)C=CC(N)(O)C=C2)cc1 |
| InChI | InChI=1S/C12H14N2O2/c13-10-3-1-9(2-4-10)11(15)5-7-12(14,16)8-6-11/h1-8,15-16H,13-14H2 |
| InChIKey | FFOUVTNQJWIFBZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol?
The IUPAC name of 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol (CID 171779384) is 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol.
What is the SMILES notation for 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol?
The canonical SMILES for 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol is Nc1ccc(C2(O)C=CC(N)(O)C=C2)cc1.
What is the InChIKey of 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol?
The InChIKey is FFOUVTNQJWIFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c13-10-3-1-9(2-4-10)11(15)5-7-12(14,16)8-6-11/h1-8,15-16H,13-14H2.
What are the key properties of 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol?
1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol has a molecular weight of 218.26 g/mol, XLogP of 0.23, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-(4-aminophenyl)cyclohexa-2,5-diene-1,4-diol is sourced from PubChem (CID 171779384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).