About (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile
(2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile (PubChem CID 171780433) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile.
Molecular Properties
| Compound Name | (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile |
| PubChem CID | 171780433 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C12H14N2/c1-9-5-10(11(8-13)14-4)7-12(2,3)6-9/h5H,6-7H2,1-3H3/b11-10- |
| InChIKey | NVGCVAQDGVVIQA-KHPPLWFESA-N |
| XLogP | 3.45 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile?
The IUPAC name of (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile (CID 171780433) is (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile.
What is the SMILES notation for (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile?
The canonical SMILES for (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile is [C-]#[N+]/C(C#N)=C1/C=C(C)CC(C)(C)C1.
What is the InChIKey of (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile?
The InChIKey is NVGCVAQDGVVIQA-KHPPLWFESA-N. The full InChI is InChI=1S/C12H14N2/c1-9-5-10(11(8-13)14-4)7-12(2,3)6-9/h5H,6-7H2,1-3H3/b11-10-.
What are the key properties of (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile?
(2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile has a molecular weight of 186.26 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-isocyano-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetonitrile is sourced from PubChem (CID 171780433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).