About methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate
methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate (PubChem CID 171780577) has the molecular formula C22H20O4
and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate |
| PubChem CID | 171780577 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate |
| SMILES | CC=C=CCC1(C(=O)OC)C(=O)c2ccccc2OC1c1ccccc1 |
| InChI | InChI=1S/C22H20O4/c1-3-4-10-15-22(21(24)25-2)19(23)17-13-8-9-14-18(17)26-20(22)16-11-6-5-7-12-16/h3,5-14,20H,15H2,1-2H3 |
| InChIKey | FMJRDDSQSMKUJM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate?
The IUPAC name of methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate (CID 171780577) is methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate.
What is the SMILES notation for methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate?
The canonical SMILES for methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate is CC=C=CCC1(C(=O)OC)C(=O)c2ccccc2OC1c1ccccc1.
What is the InChIKey of methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate?
The InChIKey is FMJRDDSQSMKUJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O4/c1-3-4-10-15-22(21(24)25-2)19(23)17-13-8-9-14-18(17)26-20(22)16-11-6-5-7-12-16/h3,5-14,20H,15H2,1-2H3.
What are the key properties of methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate?
methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate has a molecular weight of 348.40 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-3-penta-2,3-dienyl-2-phenyl-2H-chromene-3-carboxylate is sourced from PubChem (CID 171780577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).