C19H13Cl4NO3 — CID 171780917
(3E,5E)-3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one (PubChem CID 171780917) has the molecular formula C19H13Cl4NO3 and a molecular weight of 445.13 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 171780917 |
| Molecular Formula | C19H13Cl4NO3 |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Cl)c(O)c(Cl)c2)CNC/C1=C\c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C19H13Cl4NO3/c20-13-3-9(4-14(21)18(13)26)1-11-7-24-8-12(17(11)25)2-10-5-15(22)19(27)16(23)6-10/h1-6,24,26-27H,7-8H2/b11-1+,12-2+ |
| InChIKey | JILRFGYLJUOIJI-NJDSBKIZSA-N |
| XLogP | 5.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|