About 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline
4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline (PubChem CID 171781096) has the molecular formula C14H16N2O4
and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline.
Molecular Properties
| Compound Name | 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline |
| PubChem CID | 171781096 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline |
| SMILES | CCc1cc(N(O)O)ccc1-c1ccc(N(O)O)cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-2-10-9-13(16(19)20)7-8-14(10)11-3-5-12(6-4-11)15(17)18/h3-9,17-20H,2H2,1H3 |
| InChIKey | STAXODTVWAXFSI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline?
The IUPAC name of 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline (CID 171781096) is 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline.
What is the SMILES notation for 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline?
The canonical SMILES for 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline is CCc1cc(N(O)O)ccc1-c1ccc(N(O)O)cc1.
What is the InChIKey of 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline?
The InChIKey is STAXODTVWAXFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4/c1-2-10-9-13(16(19)20)7-8-14(10)11-3-5-12(6-4-11)15(17)18/h3-9,17-20H,2H2,1H3.
What are the key properties of 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline?
4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline has a molecular weight of 276.29 g/mol, XLogP of 3.09, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(dihydroxyamino)phenyl]-3-ethyl-N,N-dihydroxyaniline is sourced from PubChem (CID 171781096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).