C27H34ClFN6O2Si — CID 171781436
N-[6-(5-chloro-2-fluorophenyl)-3-[2-(dimethylamino)ethoxy]pyridazin-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 171781436) has the molecular formula C27H34ClFN6O2Si and a molecular weight of 557.15 g/mol. Its IUPAC name is N-[6-(5-chloro-2-fluorophenyl)-3-[2-(dimethylamino)ethoxy]pyridazin-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | N-[6-(5-chloro-2-fluorophenyl)-3-[2-(dimethylamino)ethoxy]pyridazin-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 171781436 |
| Molecular Formula | C27H34ClFN6O2Si |
| Molecular Weight | 557.15 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | N-[6-(5-chloro-2-fluorophenyl)-3-[2-(dimethylamino)ethoxy]pyridazin-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CN(C)CCOc1nnc(-c2cc(Cl)ccc2F)cc1Nc1ccnc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C27H34ClFN6O2Si/c1-34(2)12-13-37-27-25(17-24(32-33-27)21-16-19(28)6-7-22(21)29)31-23-8-10-30-26-20(23)9-11-35(26)18-36-14-15-38(3,4)5/h6-11,16-17H,12-15,18H2,1-5H3,(H,30,31,32) |
| InChIKey | ISPSHDUIZWBABP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.15 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|