C16H19NO3S — CID 171781598
N-(4-hydroxycyclohexyl)-6-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 171781598) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-6-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-hydroxycyclohexyl)-6-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 171781598 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-6-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NC3CCC(O)CC3)sc2c1 |
| InChI | InChI=1S/C16H19NO3S/c1-20-13-7-2-10-8-15(21-14(10)9-13)16(19)17-11-3-5-12(18)6-4-11/h2,7-9,11-12,18H,3-6H2,1H3,(H,17,19) |
| InChIKey | TYJNXXRLMKHBEW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |