C12H9Cl2FN4 — CID 171783382
2,7-dichloro-4-(2,5-dihydropyrrol-1-yl)-8-fluoro-5-methylpyrido[4,3-d]pyrimidine (PubChem CID 171783382) has the molecular formula C12H9Cl2FN4 and a molecular weight of 299.14 g/mol. Its IUPAC name is 2,7-dichloro-4-(2,5-dihydropyrrol-1-yl)-8-fluoro-5-methylpyrido[4,3-d]pyrimidine.
| Compound Name | 2,7-dichloro-4-(2,5-dihydropyrrol-1-yl)-8-fluoro-5-methylpyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 171783382 |
| Molecular Formula | C12H9Cl2FN4 |
| Molecular Weight | 299.14 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2,7-dichloro-4-(2,5-dihydropyrrol-1-yl)-8-fluoro-5-methylpyrido[4,3-d]pyrimidine |
| SMILES | Cc1nc(Cl)c(F)c2nc(Cl)nc(N3CC=CC3)c12 |
| InChI | InChI=1S/C12H9Cl2FN4/c1-6-7-9(8(15)10(13)16-6)17-12(14)18-11(7)19-4-2-3-5-19/h2-3H,4-5H2,1H3 |
| InChIKey | WFSLHHFZZOQKRQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|