About 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid
4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid (PubChem CID 171784380) has the molecular formula C16H13N3O2S
and a molecular weight of 311.37 g/mol. Its IUPAC name is 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid |
| PubChem CID | 171784380 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid |
| SMILES | Cc1nc(C2CC2c2ccc(C(=O)O)cc2)c2ncsc2n1 |
| InChI | InChI=1S/C16H13N3O2S/c1-8-18-13(14-15(19-8)22-7-17-14)12-6-11(12)9-2-4-10(5-3-9)16(20)21/h2-5,7,11-12H,6H2,1H3,(H,20,21) |
| InChIKey | USNDZFTZRYFDGD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid?
The IUPAC name of 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid (CID 171784380) is 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid.
What is the SMILES notation for 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid?
The canonical SMILES for 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid is Cc1nc(C2CC2c2ccc(C(=O)O)cc2)c2ncsc2n1.
What is the InChIKey of 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid?
The InChIKey is USNDZFTZRYFDGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2S/c1-8-18-13(14-15(19-8)22-7-17-14)12-6-11(12)9-2-4-10(5-3-9)16(20)21/h2-5,7,11-12H,6H2,1H3,(H,20,21).
What are the key properties of 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid?
4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid has a molecular weight of 311.37 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoic acid is sourced from PubChem (CID 171784380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).