About [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate
[(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate (PubChem CID 171784629) has the molecular formula C21H20F2N2OS
and a molecular weight of 386.47 g/mol. Its IUPAC name is [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate.
Molecular Properties
| Compound Name | [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate |
| PubChem CID | 171784629 |
| Molecular Formula | C21H20F2N2OS |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate |
| SMILES | CCN(CC)C(=O)C(F)(F)/C=C(/SC#N)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20F2N2OS/c1-3-25(4-2)20(26)21(22,23)14-19(27-15-24)18-12-10-17(11-13-18)16-8-6-5-7-9-16/h5-14H,3-4H2,1-2H3/b19-14+ |
| InChIKey | RDUNEHDHMMJKEO-XMHGGMMESA-N |
| XLogP | 5.41 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate?
The IUPAC name of [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate (CID 171784629) is [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate.
What is the SMILES notation for [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate?
The canonical SMILES for [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate is CCN(CC)C(=O)C(F)(F)/C=C(/SC#N)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate?
The InChIKey is RDUNEHDHMMJKEO-XMHGGMMESA-N. The full InChI is InChI=1S/C21H20F2N2OS/c1-3-25(4-2)20(26)21(22,23)14-19(27-15-24)18-12-10-17(11-13-18)16-8-6-5-7-9-16/h5-14H,3-4H2,1-2H3/b19-14+.
What are the key properties of [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate?
[(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate has a molecular weight of 386.47 g/mol, XLogP of 5.41, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-(diethylamino)-3,3-difluoro-4-oxo-1-(4-phenylphenyl)but-1-enyl] thiocyanate is sourced from PubChem (CID 171784629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).