About methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate
methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate (PubChem CID 171784704) has the molecular formula C23H22BrNO2
and a molecular weight of 424.34 g/mol. Its IUPAC name is methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate.
Molecular Properties
| Compound Name | methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate |
| PubChem CID | 171784704 |
| Molecular Formula | C23H22BrNO2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate |
| SMILES | COC(=O)C(CC(c1ccccc1)c1ccccc1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H22BrNO2/c1-27-23(26)22(25-20-14-12-19(24)13-15-20)16-21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,21-22,25H,16H2,1H3 |
| InChIKey | QAZSWHDIYUFXOO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate?
The IUPAC name of methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate (CID 171784704) is methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate.
What is the SMILES notation for methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate?
The canonical SMILES for methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate is COC(=O)C(CC(c1ccccc1)c1ccccc1)Nc1ccc(Br)cc1.
What is the InChIKey of methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate?
The InChIKey is QAZSWHDIYUFXOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22BrNO2/c1-27-23(26)22(25-20-14-12-19(24)13-15-20)16-21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,21-22,25H,16H2,1H3.
What are the key properties of methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate?
methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate has a molecular weight of 424.34 g/mol, XLogP of 5.62, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-bromoanilino)-4,4-diphenylbutanoate is sourced from PubChem (CID 171784704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).