C7H6N8O — CID 171785298
12-hydroxy-6-imino-3,7,8,10,11,12-hexazatricyclo[7.4.0.02,7]trideca-1(13),2,4,8,10-pentaen-13-amine (PubChem CID 171785298) has the molecular formula C7H6N8O and a molecular weight of 218.18 g/mol. Its IUPAC name is 12-hydroxy-6-imino-3,7,8,10,11,12-hexazatricyclo[7.4.0.02,7]trideca-1(13),2,4,8,10-pentaen-13-amine.
| Compound Name | 12-hydroxy-6-imino-3,7,8,10,11,12-hexazatricyclo[7.4.0.02,7]trideca-1(13),2,4,8,10-pentaen-13-amine |
|---|---|
| PubChem CID | 171785298 |
| Molecular Formula | C7H6N8O |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 12-hydroxy-6-imino-3,7,8,10,11,12-hexazatricyclo[7.4.0.02,7]trideca-1(13),2,4,8,10-pentaen-13-amine |
| SMILES | [H]/N=c1\ccnc2c3c(N)n(O)nnc3nn12 |
| InChI | InChI=1S/C7H6N8O/c8-3-1-2-10-7-4-5(9)15(16)13-11-6(4)12-14(3)7/h1-2,8,16H,9H2/b8-3+ |
| InChIKey | WKXKZMLZSFTHDD-FPYGCLRLSA-N |
| XLogP | -1.23 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|