About ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane
ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane (PubChem CID 171786053) has the molecular formula C16H35N3
and a molecular weight of 269.48 g/mol. Its IUPAC name is ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane |
| PubChem CID | 171786053 |
| Molecular Formula | C16H35N3 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.28 |
| IUPAC Name | ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane |
| SMILES | CC.CC.CN1CCC(N2CC3(CN(C)C3)C2)CC1 |
| InChI | InChI=1S/C12H23N3.2C2H6/c1-13-5-3-11(4-6-13)15-9-12(10-15)7-14(2)8-12;2*1-2/h11H,3-10H2,1-2H3;2*1-2H3 |
| InChIKey | VFFHVCVQDKKZCB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane?
The IUPAC name of ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane (CID 171786053) is ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane.
What is the SMILES notation for ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane?
The canonical SMILES for ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane is CC.CC.CN1CCC(N2CC3(CN(C)C3)C2)CC1.
What is the InChIKey of ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane?
The InChIKey is VFFHVCVQDKKZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3.2C2H6/c1-13-5-3-11(4-6-13)15-9-12(10-15)7-14(2)8-12;2*1-2/h11H,3-10H2,1-2H3;2*1-2H3.
What are the key properties of ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane?
ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane has a molecular weight of 269.48 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-2-(1-methylpiperidin-4-yl)-2,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 171786053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).