About 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol
2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol (PubChem CID 171786078) has the molecular formula C16H25FO
and a molecular weight of 252.37 g/mol. Its IUPAC name is 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol.
Molecular Properties
| Compound Name | 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol |
| PubChem CID | 171786078 |
| Molecular Formula | C16H25FO |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol |
| SMILES | C=Cc1ccc(F)c(C)c1/C(C)=C\C.CC.CO |
| InChI | InChI=1S/C13H15F.C2H6.CH4O/c1-5-9(3)13-10(4)12(14)8-7-11(13)6-2;2*1-2/h5-8H,2H2,1,3-4H3;1-2H3;2H,1H3/b9-5-;; |
| InChIKey | ODOKIAPTHDPSPQ-XDYVNXDCSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol?
The IUPAC name of 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol (CID 171786078) is 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol.
What is the SMILES notation for 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol?
The canonical SMILES for 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol is C=Cc1ccc(F)c(C)c1/C(C)=C\C.CC.CO.
What is the InChIKey of 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol?
The InChIKey is ODOKIAPTHDPSPQ-XDYVNXDCSA-N. The full InChI is InChI=1S/C13H15F.C2H6.CH4O/c1-5-9(3)13-10(4)12(14)8-7-11(13)6-2;2*1-2/h5-8H,2H2,1,3-4H3;1-2H3;2H,1H3/b9-5-;;.
What are the key properties of 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol?
2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol has a molecular weight of 252.37 g/mol, XLogP of 4.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-but-2-en-2-yl]-1-ethenyl-4-fluoro-3-methylbenzene;ethane;methanol is sourced from PubChem (CID 171786078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).