C11H13N3O — CID 171786858
5,6,8,10,11,11a-hexahydropyrazino[1,2-h][1,7]naphthyridin-9-one (PubChem CID 171786858) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 5,6,8,10,11,11a-hexahydropyrazino[1,2-h][1,7]naphthyridin-9-one.
| Compound Name | 5,6,8,10,11,11a-hexahydropyrazino[1,2-h][1,7]naphthyridin-9-one |
|---|---|
| PubChem CID | 171786858 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5,6,8,10,11,11a-hexahydropyrazino[1,2-h][1,7]naphthyridin-9-one |
| SMILES | O=C1CN2CCc3cccnc3C2CN1 |
| InChI | InChI=1S/C11H13N3O/c15-10-7-14-5-3-8-2-1-4-12-11(8)9(14)6-13-10/h1-2,4,9H,3,5-7H2,(H,13,15) |
| InChIKey | QTCMJGXXEUHHTF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |