C17H16CsF4N2O2 — CID 171787113
CID 171787113 (PubChem CID 171787113) has the molecular formula C17H16CsF4N2O2 and a molecular weight of 489.22 g/mol.
| Compound Name | CID 171787113 |
|---|---|
| PubChem CID | 171787113 |
| Molecular Formula | C17H16CsF4N2O2 |
| Molecular Weight | 489.22 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | — |
| SMILES | CC(Oc1cc(CNC(=O)Cc2cccc(F)c2)ccn1)C(F)(F)F.[Cs] |
| InChI | InChI=1S/C17H16F4N2O2.Cs/c1-11(17(19,20)21)25-16-9-13(5-6-22-16)10-23-15(24)8-12-3-2-4-14(18)7-12;/h2-7,9,11H,8,10H2,1H3,(H,23,24); |
| InChIKey | DCUNFZUYOHQHGV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |