C19H19F4N3O2 — CID 171787331
1-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]urea (PubChem CID 171787331) has the molecular formula C19H19F4N3O2 and a molecular weight of 397.37 g/mol. Its IUPAC name is 1-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]urea.
| Compound Name | 1-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 171787331 |
| Molecular Formula | C19H19F4N3O2 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]urea |
| SMILES | O=C(NCc1ccnc(OCC(F)(F)F)c1)NC1CCCc2c(F)cccc21 |
| InChI | InChI=1S/C19H19F4N3O2/c20-15-5-1-4-14-13(15)3-2-6-16(14)26-18(27)25-10-12-7-8-24-17(9-12)28-11-19(21,22)23/h1,4-5,7-9,16H,2-3,6,10-11H2,(H2,25,26,27) |
| InChIKey | PIUDEJKPSSGNFV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |