C16H13ClFNO2 — CID 171787789
1-benzyl-6-chloro-5-fluoro-2,3-dihydroindole-4-carboxylic acid (PubChem CID 171787789) has the molecular formula C16H13ClFNO2 and a molecular weight of 305.74 g/mol. Its IUPAC name is 1-benzyl-6-chloro-5-fluoro-2,3-dihydroindole-4-carboxylic acid.
| Compound Name | 1-benzyl-6-chloro-5-fluoro-2,3-dihydroindole-4-carboxylic acid |
|---|---|
| PubChem CID | 171787789 |
| Molecular Formula | C16H13ClFNO2 |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 1-benzyl-6-chloro-5-fluoro-2,3-dihydroindole-4-carboxylic acid |
| SMILES | O=C(O)c1c(F)c(Cl)cc2c1CCN2Cc1ccccc1 |
| InChI | InChI=1S/C16H13ClFNO2/c17-12-8-13-11(14(15(12)18)16(20)21)6-7-19(13)9-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2,(H,20,21) |
| InChIKey | JNODBJCOTBZURG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |