About 6,7-difluoro-3,4-dihydro-2H-thiochromene
6,7-difluoro-3,4-dihydro-2H-thiochromene (PubChem CID 171787807) has the molecular formula C9H8F2S
and a molecular weight of 186.23 g/mol. Its IUPAC name is 6,7-difluoro-3,4-dihydro-2H-thiochromene.
Molecular Properties
| Compound Name | 6,7-difluoro-3,4-dihydro-2H-thiochromene |
| PubChem CID | 171787807 |
| Molecular Formula | C9H8F2S |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 6,7-difluoro-3,4-dihydro-2H-thiochromene |
| SMILES | Fc1cc2c(cc1F)SCCC2 |
| InChI | InChI=1S/C9H8F2S/c10-7-4-6-2-1-3-12-9(6)5-8(7)11/h4-5H,1-3H2 |
| InChIKey | KMGLQSOOZAJMSZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,7-difluoro-3,4-dihydro-2H-thiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoro-3,4-dihydro-2H-thiochromene?
The IUPAC name of 6,7-difluoro-3,4-dihydro-2H-thiochromene (CID 171787807) is 6,7-difluoro-3,4-dihydro-2H-thiochromene.
What is the SMILES notation for 6,7-difluoro-3,4-dihydro-2H-thiochromene?
The canonical SMILES for 6,7-difluoro-3,4-dihydro-2H-thiochromene is Fc1cc2c(cc1F)SCCC2.
What is the InChIKey of 6,7-difluoro-3,4-dihydro-2H-thiochromene?
The InChIKey is KMGLQSOOZAJMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2S/c10-7-4-6-2-1-3-12-9(6)5-8(7)11/h4-5H,1-3H2.
What are the key properties of 6,7-difluoro-3,4-dihydro-2H-thiochromene?
6,7-difluoro-3,4-dihydro-2H-thiochromene has a molecular weight of 186.23 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoro-3,4-dihydro-2H-thiochromene is sourced from PubChem (CID 171787807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).