About methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate
methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate (PubChem CID 171788018) has the molecular formula C16H16ClNO4S
and a molecular weight of 353.83 g/mol. Its IUPAC name is methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate.
Molecular Properties
| Compound Name | methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate |
| PubChem CID | 171788018 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate |
| SMILES | COC(=O)c1c(OC)c(Cl)cc2c1OCCN2Cc1ccsc1 |
| InChI | InChI=1S/C16H16ClNO4S/c1-20-14-11(17)7-12-15(13(14)16(19)21-2)22-5-4-18(12)8-10-3-6-23-9-10/h3,6-7,9H,4-5,8H2,1-2H3 |
| InChIKey | GCBVQRHJFZAQBX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate?
The IUPAC name of methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate (CID 171788018) is methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate.
What is the SMILES notation for methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate?
The canonical SMILES for methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate is COC(=O)c1c(OC)c(Cl)cc2c1OCCN2Cc1ccsc1.
What is the InChIKey of methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate?
The InChIKey is GCBVQRHJFZAQBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClNO4S/c1-20-14-11(17)7-12-15(13(14)16(19)21-2)22-5-4-18(12)8-10-3-6-23-9-10/h3,6-7,9H,4-5,8H2,1-2H3.
What are the key properties of methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate?
methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate has a molecular weight of 353.83 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-7-methoxy-4-(thiophen-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-8-carboxylate is sourced from PubChem (CID 171788018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).