C20H19ClF3N5S — CID 171788204
6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-chloro-2-methylsulfanylanilino)-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 171788204) has the molecular formula C20H19ClF3N5S and a molecular weight of 453.92 g/mol. Its IUPAC name is 6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-chloro-2-methylsulfanylanilino)-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-chloro-2-methylsulfanylanilino)-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171788204 |
| Molecular Formula | C20H19ClF3N5S |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-chloro-2-methylsulfanylanilino)-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CSc1ccc(Cl)cc1Nc1nc(N2C[C@H]3CNC[C@H]3C2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C20H19ClF3N5S/c1-30-17-3-2-13(21)4-16(17)27-19-14(6-25)15(20(22,23)24)5-18(28-19)29-9-11-7-26-8-12(11)10-29/h2-5,11-12,26H,7-10H2,1H3,(H,27,28)/t11-,12+ |
| InChIKey | YZEXSAXJTBDPCU-TXEJJXNPSA-N |
| XLogP | 4.75 |
| TPSA | 63.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |