C15H14F2N4O3 — CID 171788321
2-(1,2-difluoroethyl)-N-(2,6-dioxopiperidin-3-yl)-1H-benzimidazole-4-carboxamide (PubChem CID 171788321) has the molecular formula C15H14F2N4O3 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-(1,2-difluoroethyl)-N-(2,6-dioxopiperidin-3-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-(1,2-difluoroethyl)-N-(2,6-dioxopiperidin-3-yl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 171788321 |
| Molecular Formula | C15H14F2N4O3 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-(1,2-difluoroethyl)-N-(2,6-dioxopiperidin-3-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2cccc3[nH]c(C(F)CF)nc23)C(=O)N1 |
| InChI | InChI=1S/C15H14F2N4O3/c16-6-8(17)13-18-9-3-1-2-7(12(9)21-13)14(23)19-10-4-5-11(22)20-15(10)24/h1-3,8,10H,4-6H2,(H,18,21)(H,19,23)(H,20,22,24) |
| InChIKey | GVKWTEGVPYJMNB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|