About 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane
3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane (PubChem CID 171788445) has the molecular formula C20H31NO4
and a molecular weight of 349.47 g/mol. Its IUPAC name is 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane.
Molecular Properties
| Compound Name | 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane |
| PubChem CID | 171788445 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane |
| SMILES | CC.CCc1c(OC)cc(N)cc1C(=O)CC(CCC(C)=O)C(C)=O |
| InChI | InChI=1S/C18H25NO4.C2H6/c1-5-15-16(9-14(19)10-18(15)23-4)17(22)8-13(12(3)21)7-6-11(2)20;1-2/h9-10,13H,5-8,19H2,1-4H3;1-2H3 |
| InChIKey | NMPFSDZQXSVDCS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane?
The IUPAC name of 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane (CID 171788445) is 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane.
What is the SMILES notation for 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane?
The canonical SMILES for 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane is CC.CCc1c(OC)cc(N)cc1C(=O)CC(CCC(C)=O)C(C)=O.
What is the InChIKey of 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane?
The InChIKey is NMPFSDZQXSVDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO4.C2H6/c1-5-15-16(9-14(19)10-18(15)23-4)17(22)8-13(12(3)21)7-6-11(2)20;1-2/h9-10,13H,5-8,19H2,1-4H3;1-2H3.
What are the key properties of 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane?
3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane has a molecular weight of 349.47 g/mol, XLogP of 4.01, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-1-(5-amino-2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane is sourced from PubChem (CID 171788445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).