About ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one
ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one (PubChem CID 171788634) has the molecular formula C20H32N2O3
and a molecular weight of 348.49 g/mol. Its IUPAC name is ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one.
Molecular Properties
| Compound Name | ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one |
| PubChem CID | 171788634 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one |
| SMILES | C=C1CCC(C)C(=O)N1.CC.COc1cccc(C)c1N(C)C(C)=O |
| InChI | InChI=1S/C11H15NO2.C7H11NO.C2H6/c1-8-6-5-7-10(14-4)11(8)12(3)9(2)13;1-5-3-4-6(2)8-7(5)9;1-2/h5-7H,1-4H3;5H,2-4H2,1H3,(H,8,9);1-2H3 |
| InChIKey | ZFCXTFCGJSLIPN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one?
The IUPAC name of ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one (CID 171788634) is ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one.
What is the SMILES notation for ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one?
The canonical SMILES for ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one is C=C1CCC(C)C(=O)N1.CC.COc1cccc(C)c1N(C)C(C)=O.
What is the InChIKey of ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one?
The InChIKey is ZFCXTFCGJSLIPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C7H11NO.C2H6/c1-8-6-5-7-10(14-4)11(8)12(3)9(2)13;1-5-3-4-6(2)8-7(5)9;1-2/h5-7H,1-4H3;5H,2-4H2,1H3,(H,8,9);1-2H3.
What are the key properties of ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one?
ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one has a molecular weight of 348.49 g/mol, XLogP of 4.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(2-methoxy-6-methylphenyl)-N-methylacetamide;3-methyl-6-methylidenepiperidin-2-one is sourced from PubChem (CID 171788634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).