About 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane
3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane (PubChem CID 171788851) has the molecular formula C25H39NO4
and a molecular weight of 417.59 g/mol. Its IUPAC name is 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane.
Molecular Properties
| Compound Name | 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane |
| PubChem CID | 171788851 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane |
| SMILES | CC.CCc1c(OC)cc(N2CCCCC2)cc1C(=O)CC(CCC(C)=O)C(C)=O |
| InChI | InChI=1S/C23H33NO4.C2H6/c1-5-20-21(22(27)13-18(17(3)26)10-9-16(2)25)14-19(15-23(20)28-4)24-11-7-6-8-12-24;1-2/h14-15,18H,5-13H2,1-4H3;1-2H3 |
| InChIKey | IQOGESKTAQSOJT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane?
The IUPAC name of 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane (CID 171788851) is 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane.
What is the SMILES notation for 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane?
The canonical SMILES for 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane is CC.CCc1c(OC)cc(N2CCCCC2)cc1C(=O)CC(CCC(C)=O)C(C)=O.
What is the InChIKey of 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane?
The InChIKey is IQOGESKTAQSOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33NO4.C2H6/c1-5-20-21(22(27)13-18(17(3)26)10-9-16(2)25)14-19(15-23(20)28-4)24-11-7-6-8-12-24;1-2/h14-15,18H,5-13H2,1-4H3;1-2H3.
What are the key properties of 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane?
3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane has a molecular weight of 417.59 g/mol, XLogP of 5.42, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-1-(2-ethyl-3-methoxy-5-piperidin-1-ylphenyl)heptane-1,6-dione;ethane is sourced from PubChem (CID 171788851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).