C22H25N3O5 — CID 171788885
tert-butyl 2-[[3-(2,6-dioxopiperidin-3-yl)-2-methylquinoline-6-carbonyl]amino]acetate (PubChem CID 171788885) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is tert-butyl 2-[[3-(2,6-dioxopiperidin-3-yl)-2-methylquinoline-6-carbonyl]amino]acetate.
| Compound Name | tert-butyl 2-[[3-(2,6-dioxopiperidin-3-yl)-2-methylquinoline-6-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 171788885 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | tert-butyl 2-[[3-(2,6-dioxopiperidin-3-yl)-2-methylquinoline-6-carbonyl]amino]acetate |
| SMILES | Cc1nc2ccc(C(=O)NCC(=O)OC(C)(C)C)cc2cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C22H25N3O5/c1-12-16(15-6-8-18(26)25-21(15)29)10-14-9-13(5-7-17(14)24-12)20(28)23-11-19(27)30-22(2,3)4/h5,7,9-10,15H,6,8,11H2,1-4H3,(H,23,28)(H,25,26,29) |
| InChIKey | UFAVIPRRTIVRQT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|