C45H58ClFO2 — CID 171788897
1-[(E)-4-[4-chloro-2-methyl-3-[(3Z,5E)-4,6,7-trimethylnona-3,5-dien-5-yl]phenyl]-5-[cyclobutylidene(propoxy)methyl]oct-4-enoxy]-6-fluoronaphthalene (PubChem CID 171788897) has the molecular formula C45H58ClFO2 and a molecular weight of 685.41 g/mol. Its IUPAC name is 1-[(E)-4-[4-chloro-2-methyl-3-[(3Z,5E)-4,6,7-trimethylnona-3,5-dien-5-yl]phenyl]-5-[cyclobutylidene(propoxy)methyl]oct-4-enoxy]-6-fluoronaphthalene.
| Compound Name | 1-[(E)-4-[4-chloro-2-methyl-3-[(3Z,5E)-4,6,7-trimethylnona-3,5-dien-5-yl]phenyl]-5-[cyclobutylidene(propoxy)methyl]oct-4-enoxy]-6-fluoronaphthalene |
|---|---|
| PubChem CID | 171788897 |
| Molecular Formula | C45H58ClFO2 |
| Molecular Weight | 685.41 g/mol |
| Exact Mass | 684.41 |
| IUPAC Name | 1-[(E)-4-[4-chloro-2-methyl-3-[(3Z,5E)-4,6,7-trimethylnona-3,5-dien-5-yl]phenyl]-5-[cyclobutylidene(propoxy)methyl]oct-4-enoxy]-6-fluoronaphthalene |
| SMILES | CC/C=C(C)\C(=C(\C)C(C)CC)c1c(Cl)ccc(/C(CCCOc2cccc3cc(F)ccc23)=C(\CCC)C(OCCC)=C2CCC2)c1C |
| InChI | InChI=1S/C45H58ClFO2/c1-9-16-31(6)43(32(7)30(5)12-4)44-33(8)37(25-26-41(44)46)39(40(17-10-2)45(49-27-11-3)34-18-13-19-34)21-15-28-48-42-22-14-20-35-29-36(47)23-24-38(35)42/h14,16,20,22-26,29-30H,9-13,15,17-19,21,27-28H2,1-8H3/b31-16-,40-39+,43-32+ |
| InChIKey | YJBPMSPVQKSRLE-SGKWRRSNSA-N |
| XLogP | 14.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.41 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|