C22H31N3O5 — CID 171788986
2-[7-[2-(dipropylamino)-2-oxoethoxy]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide (PubChem CID 171788986) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[7-[2-(dipropylamino)-2-oxoethoxy]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide.
| Compound Name | 2-[7-[2-(dipropylamino)-2-oxoethoxy]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
|---|---|
| PubChem CID | 171788986 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 2-[7-[2-(dipropylamino)-2-oxoethoxy]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
| SMILES | CCCC(C(=O)NC=O)N1Cc2c(OCC(=O)N(CCC)CCC)cccc2C1=O |
| InChI | InChI=1S/C22H31N3O5/c1-4-8-18(21(28)23-15-26)25-13-17-16(22(25)29)9-7-10-19(17)30-14-20(27)24(11-5-2)12-6-3/h7,9-10,15,18H,4-6,8,11-14H2,1-3H3,(H,23,26,28) |
| InChIKey | GOWFGZVXKQCUDP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|