C15H24F3N5O3 — CID 171789932
5-[[2-(methylamino)acetyl]amino]-6-oxo-3-(2,2,2-trifluoroethyl)-1,2,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,5]diazocine-8-carboxamide (PubChem CID 171789932) has the molecular formula C15H24F3N5O3 and a molecular weight of 379.38 g/mol. Its IUPAC name is 5-[[2-(methylamino)acetyl]amino]-6-oxo-3-(2,2,2-trifluoroethyl)-1,2,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,5]diazocine-8-carboxamide.
| Compound Name | 5-[[2-(methylamino)acetyl]amino]-6-oxo-3-(2,2,2-trifluoroethyl)-1,2,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,5]diazocine-8-carboxamide |
|---|---|
| PubChem CID | 171789932 |
| Molecular Formula | C15H24F3N5O3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 5-[[2-(methylamino)acetyl]amino]-6-oxo-3-(2,2,2-trifluoroethyl)-1,2,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,5]diazocine-8-carboxamide |
| SMILES | CNCC(=O)NC1CN(CC(F)(F)F)CCC2CCC(C(N)=O)N2C1=O |
| InChI | InChI=1S/C15H24F3N5O3/c1-20-6-12(24)21-10-7-22(8-15(16,17)18)5-4-9-2-3-11(13(19)25)23(9)14(10)26/h9-11,20H,2-8H2,1H3,(H2,19,25)(H,21,24) |
| InChIKey | INTPVMHBZKQHHT-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |