C18H28BClN2O3 — CID 171791427
1-[2-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperazine (PubChem CID 171791427) has the molecular formula C18H28BClN2O3 and a molecular weight of 366.70 g/mol. Its IUPAC name is 1-[2-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperazine.
| Compound Name | 1-[2-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperazine |
|---|---|
| PubChem CID | 171791427 |
| Molecular Formula | C18H28BClN2O3 |
| Molecular Weight | 366.70 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[2-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperazine |
| SMILES | CC1(C)OB(c2ccc(OCCN3CCNCC3)cc2Cl)OC1(C)C |
| InChI | InChI=1S/C18H28BClN2O3/c1-17(2)18(3,4)25-19(24-17)15-6-5-14(13-16(15)20)23-12-11-22-9-7-21-8-10-22/h5-6,13,21H,7-12H2,1-4H3 |
| InChIKey | CYIAGRREZRQENS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.70 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|