C22H20ClN5O2 — CID 171791458
3-chloro-4-[6-(1-methylcyclopropyl)oxy-9-[(4-methyl-2-pyridinyl)methyl]purin-8-yl]phenol (PubChem CID 171791458) has the molecular formula C22H20ClN5O2 and a molecular weight of 421.89 g/mol. Its IUPAC name is 3-chloro-4-[6-(1-methylcyclopropyl)oxy-9-[(4-methyl-2-pyridinyl)methyl]purin-8-yl]phenol.
| Compound Name | 3-chloro-4-[6-(1-methylcyclopropyl)oxy-9-[(4-methyl-2-pyridinyl)methyl]purin-8-yl]phenol |
|---|---|
| PubChem CID | 171791458 |
| Molecular Formula | C22H20ClN5O2 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-chloro-4-[6-(1-methylcyclopropyl)oxy-9-[(4-methyl-2-pyridinyl)methyl]purin-8-yl]phenol |
| SMILES | Cc1ccnc(Cn2c(-c3ccc(O)cc3Cl)nc3c(OC4(C)CC4)ncnc32)c1 |
| InChI | InChI=1S/C22H20ClN5O2/c1-13-5-8-24-14(9-13)11-28-19(16-4-3-15(29)10-17(16)23)27-18-20(28)25-12-26-21(18)30-22(2)6-7-22/h3-5,8-10,12,29H,6-7,11H2,1-2H3 |
| InChIKey | AVFPOCCQROYDGO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |