C19H17ClN2O — CID 171792284
N-[(1R)-1-(2-chloroquinolin-4-yl)ethyl]-2-methylbenzamide (PubChem CID 171792284) has the molecular formula C19H17ClN2O and a molecular weight of 324.81 g/mol. Its IUPAC name is N-[(1R)-1-(2-chloroquinolin-4-yl)ethyl]-2-methylbenzamide.
| Compound Name | N-[(1R)-1-(2-chloroquinolin-4-yl)ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 171792284 |
| Molecular Formula | C19H17ClN2O |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[(1R)-1-(2-chloroquinolin-4-yl)ethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N[C@H](C)c1cc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C19H17ClN2O/c1-12-7-3-4-8-14(12)19(23)21-13(2)16-11-18(20)22-17-10-6-5-9-15(16)17/h3-11,13H,1-2H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | UWNUVEHZBIFNKU-CYBMUJFWSA-N |
| XLogP | 4.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|