C42H84O2 — CID 171792492
ethane;[(7Z,26Z)-tritriaconta-7,26-dien-17-yl] pentanoate (PubChem CID 171792492) has the molecular formula C42H84O2 and a molecular weight of 621.13 g/mol. Its IUPAC name is ethane;[(7Z,26Z)-tritriaconta-7,26-dien-17-yl] pentanoate.
| Compound Name | ethane;[(7Z,26Z)-tritriaconta-7,26-dien-17-yl] pentanoate |
|---|---|
| PubChem CID | 171792492 |
| Molecular Formula | C42H84O2 |
| Molecular Weight | 621.13 g/mol |
| Exact Mass | 620.65 |
| IUPAC Name | ethane;[(7Z,26Z)-tritriaconta-7,26-dien-17-yl] pentanoate |
| SMILES | CC.CC.CCCCCC/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCC)OC(=O)CCCC |
| InChI | InChI=1S/C38H72O2.2C2H6/c1-4-7-10-12-14-16-18-20-22-24-26-28-30-32-34-37(40-38(39)36-9-6-3)35-33-31-29-27-25-23-21-19-17-15-13-11-8-5-2;2*1-2/h16-19,37H,4-15,20-36H2,1-3H3;2*1-2H3/b18-16-,19-17-;; |
| InChIKey | VGABPSKQABKPFR-QYEYIJKASA-N |
| XLogP | 15.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.13 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|