C21H22Cl2FN5 — CID 171793245
2-[2-[6-(3,4-dichloroanilino)-8-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]ethyl]guanidine (PubChem CID 171793245) has the molecular formula C21H22Cl2FN5 and a molecular weight of 434.35 g/mol. Its IUPAC name is 2-[2-[6-(3,4-dichloroanilino)-8-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]ethyl]guanidine.
| Compound Name | 2-[2-[6-(3,4-dichloroanilino)-8-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 171793245 |
| Molecular Formula | C21H22Cl2FN5 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[2-[6-(3,4-dichloroanilino)-8-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]ethyl]guanidine |
| SMILES | NC(N)=NCCn1c2c(c3cc(Nc4ccc(Cl)c(Cl)c4)cc(F)c31)CCCC2 |
| InChI | InChI=1S/C21H22Cl2FN5/c22-16-6-5-12(10-17(16)23)28-13-9-15-14-3-1-2-4-19(14)29(8-7-27-21(25)26)20(15)18(24)11-13/h5-6,9-11,28H,1-4,7-8H2,(H4,25,26,27) |
| InChIKey | BPXFVDNQJLNNFK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|