About 3,5-dichloro-N-ethylpyridin-4-amine;propane
3,5-dichloro-N-ethylpyridin-4-amine;propane (PubChem CID 171793312) has the molecular formula C10H16Cl2N2
and a molecular weight of 235.16 g/mol. Its IUPAC name is 3,5-dichloro-N-ethylpyridin-4-amine;propane.
Molecular Properties
| Compound Name | 3,5-dichloro-N-ethylpyridin-4-amine;propane |
| PubChem CID | 171793312 |
| Molecular Formula | C10H16Cl2N2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 3,5-dichloro-N-ethylpyridin-4-amine;propane |
| SMILES | CCC.CCNc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C7H8Cl2N2.C3H8/c1-2-11-7-5(8)3-10-4-6(7)9;1-3-2/h3-4H,2H2,1H3,(H,10,11);3H2,1-2H3 |
| InChIKey | DXBCKHPXCFLVAM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dichloro-N-ethylpyridin-4-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-ethylpyridin-4-amine;propane?
The IUPAC name of 3,5-dichloro-N-ethylpyridin-4-amine;propane (CID 171793312) is 3,5-dichloro-N-ethylpyridin-4-amine;propane.
What is the SMILES notation for 3,5-dichloro-N-ethylpyridin-4-amine;propane?
The canonical SMILES for 3,5-dichloro-N-ethylpyridin-4-amine;propane is CCC.CCNc1c(Cl)cncc1Cl.
What is the InChIKey of 3,5-dichloro-N-ethylpyridin-4-amine;propane?
The InChIKey is DXBCKHPXCFLVAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl2N2.C3H8/c1-2-11-7-5(8)3-10-4-6(7)9;1-3-2/h3-4H,2H2,1H3,(H,10,11);3H2,1-2H3.
What are the key properties of 3,5-dichloro-N-ethylpyridin-4-amine;propane?
3,5-dichloro-N-ethylpyridin-4-amine;propane has a molecular weight of 235.16 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-ethylpyridin-4-amine;propane is sourced from PubChem (CID 171793312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).