C21H21Cl2F2N5 — CID 171793317
2-[2-[6-(3,4-dichloroanilino)-3,3-difluoro-2,4-dihydro-1H-carbazol-9-yl]ethyl]guanidine (PubChem CID 171793317) has the molecular formula C21H21Cl2F2N5 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-[2-[6-(3,4-dichloroanilino)-3,3-difluoro-2,4-dihydro-1H-carbazol-9-yl]ethyl]guanidine.
| Compound Name | 2-[2-[6-(3,4-dichloroanilino)-3,3-difluoro-2,4-dihydro-1H-carbazol-9-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 171793317 |
| Molecular Formula | C21H21Cl2F2N5 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-[2-[6-(3,4-dichloroanilino)-3,3-difluoro-2,4-dihydro-1H-carbazol-9-yl]ethyl]guanidine |
| SMILES | NC(N)=NCCn1c2c(c3cc(Nc4ccc(Cl)c(Cl)c4)ccc31)CC(F)(F)CC2 |
| InChI | InChI=1S/C21H21Cl2F2N5/c22-16-3-1-13(10-17(16)23)29-12-2-4-18-14(9-12)15-11-21(24,25)6-5-19(15)30(18)8-7-28-20(26)27/h1-4,9-10,29H,5-8,11H2,(H4,26,27,28) |
| InChIKey | KEXUFILCIQGTOY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 81.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|