About 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine
9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine (PubChem CID 171793775) has the molecular formula C20H16Cl3N3
and a molecular weight of 404.73 g/mol. Its IUPAC name is 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine.
Molecular Properties
| Compound Name | 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine |
| PubChem CID | 171793775 |
| Molecular Formula | C20H16Cl3N3 |
| Molecular Weight | 404.73 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine |
| SMILES | NCCn1c2cc(Nc3ccc(Cl)cc3)ccc2c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C20H16Cl3N3/c21-12-1-3-13(4-2-12)25-14-5-6-15-16-10-17(22)18(23)11-20(16)26(8-7-24)19(15)9-14/h1-6,9-11,25H,7-8,24H2 |
| InChIKey | CLGYQLQFFQXVMT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.73 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine?
The IUPAC name of 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine (CID 171793775) is 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine.
What is the SMILES notation for 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine?
The canonical SMILES for 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine is NCCn1c2cc(Nc3ccc(Cl)cc3)ccc2c2cc(Cl)c(Cl)cc21.
What is the InChIKey of 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine?
The InChIKey is CLGYQLQFFQXVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16Cl3N3/c21-12-1-3-13(4-2-12)25-14-5-6-15-16-10-17(22)18(23)11-20(16)26(8-7-24)19(15)9-14/h1-6,9-11,25H,7-8,24H2.
What are the key properties of 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine?
9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine has a molecular weight of 404.73 g/mol, XLogP of 6.46, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2-aminoethyl)-6,7-dichloro-N-(4-chlorophenyl)carbazol-2-amine is sourced from PubChem (CID 171793775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).