C24H23Cl2F3N6 — CID 171793793
2-N-(3,4-dichlorophenyl)-9-N-[2-(methylamino)ethyl]-7-(trifluoromethyl)acridine-2,9-diamine;methanimidamide (PubChem CID 171793793) has the molecular formula C24H23Cl2F3N6 and a molecular weight of 523.39 g/mol. Its IUPAC name is 2-N-(3,4-dichlorophenyl)-9-N-[2-(methylamino)ethyl]-7-(trifluoromethyl)acridine-2,9-diamine;methanimidamide.
| Compound Name | 2-N-(3,4-dichlorophenyl)-9-N-[2-(methylamino)ethyl]-7-(trifluoromethyl)acridine-2,9-diamine;methanimidamide |
|---|---|
| PubChem CID | 171793793 |
| Molecular Formula | C24H23Cl2F3N6 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 2-N-(3,4-dichlorophenyl)-9-N-[2-(methylamino)ethyl]-7-(trifluoromethyl)acridine-2,9-diamine;methanimidamide |
| SMILES | CNCCNc1c2cc(Nc3ccc(Cl)c(Cl)c3)ccc2nc2ccc(C(F)(F)F)cc12.[H]/N=C/N |
| InChI | InChI=1S/C23H19Cl2F3N4.CH4N2/c1-29-8-9-30-22-16-10-13(23(26,27)28)2-6-20(16)32-21-7-4-14(11-17(21)22)31-15-3-5-18(24)19(25)12-15;2-1-3/h2-7,10-12,29,31H,8-9H2,1H3,(H,30,32);1H,(H3,2,3) |
| InChIKey | OPKGBHPNZVCEMF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|